C19H36N2O — CID 90676701
4-[(5R,6R,9R,13S)-7-butyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol (PubChem CID 90676701) has the molecular formula C19H36N2O and a molecular weight of 308.51 g/mol. Its IUPAC name is 4-[(5R,6R,9R,13S)-7-butyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol.
| Compound Name | 4-[(5R,6R,9R,13S)-7-butyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol |
|---|---|
| PubChem CID | 90676701 |
| Molecular Formula | C19H36N2O |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.28 |
| IUPAC Name | 4-[(5R,6R,9R,13S)-7-butyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol |
| SMILES | CCCCN1C[C@H]2CCCN3CCC[C@@H]([C@H]23)[C@H]1CCCCO |
| InChI | InChI=1S/C19H36N2O/c1-2-3-11-21-15-16-8-6-12-20-13-7-9-17(19(16)20)18(21)10-4-5-14-22/h16-19,22H,2-15H2,1H3/t16-,17-,18-,19+/m1/s1 |
| InChIKey | LJTIFOWCSGPLRE-MKXGPGLRSA-N |
| XLogP | 3.12 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|