C19H19N3O7 — CID 9067837
[2-(4-methyl-3-nitroanilino)-2-oxoethyl] (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9067837) has the molecular formula C19H19N3O7 and a molecular weight of 401.38 g/mol. Its IUPAC name is [2-(4-methyl-3-nitroanilino)-2-oxoethyl] (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(4-methyl-3-nitroanilino)-2-oxoethyl] (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9067837 |
| Molecular Formula | C19H19N3O7 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | [2-(4-methyl-3-nitroanilino)-2-oxoethyl] (3S)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)[C@H]2CC(=O)N(Cc3ccco3)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19N3O7/c1-12-4-5-14(8-16(12)22(26)27)20-17(23)11-29-19(25)13-7-18(24)21(9-13)10-15-3-2-6-28-15/h2-6,8,13H,7,9-11H2,1H3,(H,20,23)/t13-/m0/s1 |
| InChIKey | BTQVQUFRGVKMRT-ZDUSSCGKSA-N |
| XLogP | 2.03 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|