C10H11N5O2 — CID 90678608
6-[2-(4-aminophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione (PubChem CID 90678608) has the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. Its IUPAC name is 6-[2-(4-aminophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[2-(4-aminophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90678608 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 6-[2-(4-aminophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione |
| SMILES | Nc1ccc(NNc2cc(=O)[nH]c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C10H11N5O2/c11-6-1-3-7(4-2-6)14-15-8-5-9(16)13-10(17)12-8/h1-5,14H,11H2,(H3,12,13,15,16,17) |
| InChIKey | BGUCHTYNIWFOLJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|