C16H21NO — CID 90679415
(1R,14S)-14-amino-1-ethyltricyclo[7.4.1.02,7]tetradeca-2(7),3,5,11-tetraen-4-ol (PubChem CID 90679415) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (1R,14S)-14-amino-1-ethyltricyclo[7.4.1.02,7]tetradeca-2(7),3,5,11-tetraen-4-ol.
| Compound Name | (1R,14S)-14-amino-1-ethyltricyclo[7.4.1.02,7]tetradeca-2(7),3,5,11-tetraen-4-ol |
|---|---|
| PubChem CID | 90679415 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (1R,14S)-14-amino-1-ethyltricyclo[7.4.1.02,7]tetradeca-2(7),3,5,11-tetraen-4-ol |
| SMILES | CC[C@@]12CC=CCC(Cc3ccc(O)cc31)[C@@H]2N |
| InChI | InChI=1S/C16H21NO/c1-2-16-8-4-3-5-12(15(16)17)9-11-6-7-13(18)10-14(11)16/h3-4,6-7,10,12,15,18H,2,5,8-9,17H2,1H3/t12?,15-,16+/m0/s1 |
| InChIKey | DONFCAMIZWSTQQ-FFPFEORLSA-N |
| XLogP | 2.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|