C22H29NO2S — CID 18343373
(6S,7S)-7-amino-8,8-diethyl-6-(2-phenoxyethylsulfanyl)-6,7-dihydro-5H-naphthalen-2-ol (PubChem CID 18343373) has the molecular formula C22H29NO2S and a molecular weight of 371.55 g/mol. Its IUPAC name is (6S,7S)-7-amino-8,8-diethyl-6-(2-phenoxyethylsulfanyl)-6,7-dihydro-5H-naphthalen-2-ol.
| Compound Name | (6S,7S)-7-amino-8,8-diethyl-6-(2-phenoxyethylsulfanyl)-6,7-dihydro-5H-naphthalen-2-ol |
|---|---|
| PubChem CID | 18343373 |
| Molecular Formula | C22H29NO2S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (6S,7S)-7-amino-8,8-diethyl-6-(2-phenoxyethylsulfanyl)-6,7-dihydro-5H-naphthalen-2-ol |
| SMILES | CCC1(CC)c2cc(O)ccc2C[C@H](SCCOc2ccccc2)C1N |
| InChI | InChI=1S/C22H29NO2S/c1-3-22(4-2)19-15-17(24)11-10-16(19)14-20(21(22)23)26-13-12-25-18-8-6-5-7-9-18/h5-11,15,20-21,24H,3-4,12-14,23H2,1-2H3/t20-,21?/m0/s1 |
| InChIKey | ZKFSQFLQFITGIE-BGERDNNASA-N |
| XLogP | 4.51 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|