C22H30NO2S+ — CID 18343418
[1,1-diethyl-7-hydroxy-3-(2-phenoxyethylsulfanyl)-3,4-dihydro-2H-naphthalen-2-yl]azanium (PubChem CID 18343418) has the molecular formula C22H30NO2S+ and a molecular weight of 372.55 g/mol. Its IUPAC name is [1,1-diethyl-7-hydroxy-3-(2-phenoxyethylsulfanyl)-3,4-dihydro-2H-naphthalen-2-yl]azanium.
| Compound Name | [1,1-diethyl-7-hydroxy-3-(2-phenoxyethylsulfanyl)-3,4-dihydro-2H-naphthalen-2-yl]azanium |
|---|---|
| PubChem CID | 18343418 |
| Molecular Formula | C22H30NO2S+ |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | [1,1-diethyl-7-hydroxy-3-(2-phenoxyethylsulfanyl)-3,4-dihydro-2H-naphthalen-2-yl]azanium |
| SMILES | CCC1(CC)c2cc(O)ccc2CC(SCCOc2ccccc2)C1[NH3+] |
| InChI | InChI=1S/C22H29NO2S/c1-3-22(4-2)19-15-17(24)11-10-16(19)14-20(21(22)23)26-13-12-25-18-8-6-5-7-9-18/h5-11,15,20-21,24H,3-4,12-14,23H2,1-2H3/p+1 |
| InChIKey | ZKFSQFLQFITGIE-UHFFFAOYSA-O |
| XLogP | 3.80 |
| TPSA | 57.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|