C20H24ClNO2S — CID 142001695
7-(chloroamino)-8,8-dimethyl-6-(2-phenoxyethylsulfanyl)-6,7-dihydro-5H-naphthalen-2-ol (PubChem CID 142001695) has the molecular formula C20H24ClNO2S and a molecular weight of 377.94 g/mol. Its IUPAC name is 7-(chloroamino)-8,8-dimethyl-6-(2-phenoxyethylsulfanyl)-6,7-dihydro-5H-naphthalen-2-ol.
| Compound Name | 7-(chloroamino)-8,8-dimethyl-6-(2-phenoxyethylsulfanyl)-6,7-dihydro-5H-naphthalen-2-ol |
|---|---|
| PubChem CID | 142001695 |
| Molecular Formula | C20H24ClNO2S |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 7-(chloroamino)-8,8-dimethyl-6-(2-phenoxyethylsulfanyl)-6,7-dihydro-5H-naphthalen-2-ol |
| SMILES | CC1(C)c2cc(O)ccc2CC(SCCOc2ccccc2)C1NCl |
| InChI | InChI=1S/C20H24ClNO2S/c1-20(2)17-13-15(23)9-8-14(17)12-18(19(20)22-21)25-11-10-24-16-6-4-3-5-7-16/h3-9,13,18-19,22-23H,10-12H2,1-2H3 |
| InChIKey | ANFXDGAQFBPLKR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|