C17H17N5 — CID 90680235
6-(3,4-dihydro-1H-isoquinolin-2-yl)quinazoline-2,4-diamine (PubChem CID 90680235) has the molecular formula C17H17N5 and a molecular weight of 291.36 g/mol. Its IUPAC name is 6-(3,4-dihydro-1H-isoquinolin-2-yl)quinazoline-2,4-diamine.
| Compound Name | 6-(3,4-dihydro-1H-isoquinolin-2-yl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 90680235 |
| Molecular Formula | C17H17N5 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 6-(3,4-dihydro-1H-isoquinolin-2-yl)quinazoline-2,4-diamine |
| SMILES | Nc1nc(N)c2cc(N3CCc4ccccc4C3)ccc2n1 |
| InChI | InChI=1S/C17H17N5/c18-16-14-9-13(5-6-15(14)20-17(19)21-16)22-8-7-11-3-1-2-4-12(11)10-22/h1-6,9H,7-8,10H2,(H4,18,19,20,21) |
| InChIKey | GMLLQTGJSUMGPA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |