C13H17FN2O4 — CID 90681615
2-fluoro-N-[6-(hydroxyamino)-6-oxohexoxy]benzamide (PubChem CID 90681615) has the molecular formula C13H17FN2O4 and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-fluoro-N-[6-(hydroxyamino)-6-oxohexoxy]benzamide.
| Compound Name | 2-fluoro-N-[6-(hydroxyamino)-6-oxohexoxy]benzamide |
|---|---|
| PubChem CID | 90681615 |
| Molecular Formula | C13H17FN2O4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-fluoro-N-[6-(hydroxyamino)-6-oxohexoxy]benzamide |
| SMILES | O=C(CCCCCONC(=O)c1ccccc1F)NO |
| InChI | InChI=1S/C13H17FN2O4/c14-11-7-4-3-6-10(11)13(18)16-20-9-5-1-2-8-12(17)15-19/h3-4,6-7,19H,1-2,5,8-9H2,(H,15,17)(H,16,18) |
| InChIKey | ANZVMWCZDGBOFF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|