C10H11FN2O3 — CID 110495597
2-fluoro-N-[2-(methylamino)-2-oxoethoxy]benzamide (PubChem CID 110495597) has the molecular formula C10H11FN2O3 and a molecular weight of 226.21 g/mol. Its IUPAC name is 2-fluoro-N-[2-(methylamino)-2-oxoethoxy]benzamide.
| Compound Name | 2-fluoro-N-[2-(methylamino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 110495597 |
| Molecular Formula | C10H11FN2O3 |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-fluoro-N-[2-(methylamino)-2-oxoethoxy]benzamide |
| SMILES | CNC(=O)CONC(=O)c1ccccc1F |
| InChI | InChI=1S/C10H11FN2O3/c1-12-9(14)6-16-13-10(15)7-4-2-3-5-8(7)11/h2-5H,6H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | VSZVXBAFVVXTCQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|