C17H17NO3 — CID 90681776
benzo[f][1,3]benzodioxol-6-yl(piperidin-1-yl)methanone (PubChem CID 90681776) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is benzo[f][1,3]benzodioxol-6-yl(piperidin-1-yl)methanone.
| Compound Name | benzo[f][1,3]benzodioxol-6-yl(piperidin-1-yl)methanone |
|---|---|
| PubChem CID | 90681776 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | benzo[f][1,3]benzodioxol-6-yl(piperidin-1-yl)methanone |
| SMILES | O=C(c1ccc2cc3c(cc2c1)OCO3)N1CCCCC1 |
| InChI | InChI=1S/C17H17NO3/c19-17(18-6-2-1-3-7-18)13-5-4-12-9-15-16(21-11-20-15)10-14(12)8-13/h4-5,8-10H,1-3,6-7,11H2 |
| InChIKey | GKXHWKOGGAJCKE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |