C11H10BrClN2O2 — CID 90682390
3-(2-bromoethyl)-5-chloro-2-methylphthalazine-1,4-dione (PubChem CID 90682390) has the molecular formula C11H10BrClN2O2 and a molecular weight of 317.57 g/mol. Its IUPAC name is 3-(2-bromoethyl)-5-chloro-2-methylphthalazine-1,4-dione.
| Compound Name | 3-(2-bromoethyl)-5-chloro-2-methylphthalazine-1,4-dione |
|---|---|
| PubChem CID | 90682390 |
| Molecular Formula | C11H10BrClN2O2 |
| Molecular Weight | 317.57 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 3-(2-bromoethyl)-5-chloro-2-methylphthalazine-1,4-dione |
| SMILES | Cn1c(=O)c2cccc(Cl)c2c(=O)n1CCBr |
| InChI | InChI=1S/C11H10BrClN2O2/c1-14-10(16)7-3-2-4-8(13)9(7)11(17)15(14)6-5-12/h2-4H,5-6H2,1H3 |
| InChIKey | NCOZQMPYENDGMB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.57 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|