C20H25N5O2 — CID 90683531
(1-methylimidazol-4-yl)-[4-[2-[(2-methyl-1H-indol-5-yl)oxy]ethyl]piperazin-1-yl]methanone (PubChem CID 90683531) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is (1-methylimidazol-4-yl)-[4-[2-[(2-methyl-1H-indol-5-yl)oxy]ethyl]piperazin-1-yl]methanone.
| Compound Name | (1-methylimidazol-4-yl)-[4-[2-[(2-methyl-1H-indol-5-yl)oxy]ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 90683531 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (1-methylimidazol-4-yl)-[4-[2-[(2-methyl-1H-indol-5-yl)oxy]ethyl]piperazin-1-yl]methanone |
| SMILES | Cc1cc2cc(OCCN3CCN(C(=O)c4cn(C)cn4)CC3)ccc2[nH]1 |
| InChI | InChI=1S/C20H25N5O2/c1-15-11-16-12-17(3-4-18(16)22-15)27-10-9-24-5-7-25(8-6-24)20(26)19-13-23(2)14-21-19/h3-4,11-14,22H,5-10H2,1-2H3 |
| InChIKey | GVHFUPNHNGEZBV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 66.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |