C25H26N4O2 — CID 90683529
[4-[2-[(2-methyl-1H-indol-5-yl)oxy]ethyl]piperazin-1-yl]-quinolin-4-ylmethanone (PubChem CID 90683529) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is [4-[2-[(2-methyl-1H-indol-5-yl)oxy]ethyl]piperazin-1-yl]-quinolin-4-ylmethanone.
| Compound Name | [4-[2-[(2-methyl-1H-indol-5-yl)oxy]ethyl]piperazin-1-yl]-quinolin-4-ylmethanone |
|---|---|
| PubChem CID | 90683529 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | [4-[2-[(2-methyl-1H-indol-5-yl)oxy]ethyl]piperazin-1-yl]-quinolin-4-ylmethanone |
| SMILES | Cc1cc2cc(OCCN3CCN(C(=O)c4ccnc5ccccc45)CC3)ccc2[nH]1 |
| InChI | InChI=1S/C25H26N4O2/c1-18-16-19-17-20(6-7-23(19)27-18)31-15-14-28-10-12-29(13-11-28)25(30)22-8-9-26-24-5-3-2-4-21(22)24/h2-9,16-17,27H,10-15H2,1H3 |
| InChIKey | QGAMPVXEPPRANO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |