About Hydrogen (metasilicato(2-)-O)(2-methoxyethyl)mercurate(1-)
Hydrogen (metasilicato(2-)-O)(2-methoxyethyl)mercurate(1-) (PubChem CID 90684411) has the molecular formula C3H8HgO4Si
and a molecular weight of 336.77 g/mol.
Molecular Properties
| Compound Name | Hydrogen (metasilicato(2-)-O)(2-methoxyethyl)mercurate(1-) |
| PubChem CID | 90684411 |
| Molecular Formula | C3H8HgO4Si |
| Molecular Weight | 336.77 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | — |
| SMILES | COCC[Hg-]1O[Si](=O)O1.[H+] |
| InChI | InChI=1S/C3H7O.Hg.O3Si/c1-3-4-2;;1-4(2)3/h1,3H2,2H3;;/q;+1;-2/p+1 |
| InChIKey | FSNHYYQHGAEENZ-UHFFFAOYSA-O |
| XLogP | 0.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.77 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Hydrogen (metasilicato(2-)-O)(2-methoxyethyl)mercurate(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Hydrogen (metasilicato(2-)-O)(2-methoxyethyl)mercurate(1-)?
The IUPAC name of Hydrogen (metasilicato(2-)-O)(2-methoxyethyl)mercurate(1-) (CID 90684411) is not available.
What is the SMILES notation for Hydrogen (metasilicato(2-)-O)(2-methoxyethyl)mercurate(1-)?
The canonical SMILES for Hydrogen (metasilicato(2-)-O)(2-methoxyethyl)mercurate(1-) is COCC[Hg-]1O[Si](=O)O1.[H+].
What is the InChIKey of Hydrogen (metasilicato(2-)-O)(2-methoxyethyl)mercurate(1-)?
The InChIKey is FSNHYYQHGAEENZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H7O.Hg.O3Si/c1-3-4-2;;1-4(2)3/h1,3H2,2H3;;/q;+1;-2/p+1.
What are the key properties of Hydrogen (metasilicato(2-)-O)(2-methoxyethyl)mercurate(1-)?
Hydrogen (metasilicato(2-)-O)(2-methoxyethyl)mercurate(1-) has a molecular weight of 336.77 g/mol, XLogP of 0.07, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Hydrogen (metasilicato(2-)-O)(2-methoxyethyl)mercurate(1-) is sourced from PubChem (CID 90684411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).