C9H15N — CID 90686392
N-(2,3-dimethylbut-1-enyl)prop-2-en-1-imine (PubChem CID 90686392) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is N-(2,3-dimethylbut-1-enyl)prop-2-en-1-imine.
| Compound Name | N-(2,3-dimethylbut-1-enyl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 90686392 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N-(2,3-dimethylbut-1-enyl)prop-2-en-1-imine |
| SMILES | C=C/C=N/C=C(C)C(C)C |
| InChI | InChI=1S/C9H15N/c1-5-6-10-7-9(4)8(2)3/h5-8H,1H2,2-4H3/b9-7?,10-6+ |
| InChIKey | NKFQSMGVLNCCEC-CWIDIXFLSA-N |
| XLogP | 2.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|