C31H30N2 — CID 90686411
4-(9H-fluoren-1-yl)-3-methanimidoyl-N,N-dimethyl-2-(2,3,4-trimethylphenyl)aniline (PubChem CID 90686411) has the molecular formula C31H30N2 and a molecular weight of 430.60 g/mol. Its IUPAC name is 4-(9H-fluoren-1-yl)-3-methanimidoyl-N,N-dimethyl-2-(2,3,4-trimethylphenyl)aniline.
| Compound Name | 4-(9H-fluoren-1-yl)-3-methanimidoyl-N,N-dimethyl-2-(2,3,4-trimethylphenyl)aniline |
|---|---|
| PubChem CID | 90686411 |
| Molecular Formula | C31H30N2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 4-(9H-fluoren-1-yl)-3-methanimidoyl-N,N-dimethyl-2-(2,3,4-trimethylphenyl)aniline |
| SMILES | [H]/N=C/c1c(-c2cccc3c2Cc2ccccc2-3)ccc(N(C)C)c1-c1ccc(C)c(C)c1C |
| InChI | InChI=1S/C31H30N2/c1-19-13-14-23(21(3)20(19)2)31-29(18-32)27(15-16-30(31)33(4)5)26-12-8-11-25-24-10-7-6-9-22(24)17-28(25)26/h6-16,18,32H,17H2,1-5H3/b32-18+ |
| InChIKey | VDKIUDSOMARSAJ-KCSSXMTESA-N |
| XLogP | 7.58 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|