C6H7N3O — CID 90689305
ethyl 2,2-diisocyanoethanimidate (PubChem CID 90689305) has the molecular formula C6H7N3O and a molecular weight of 137.14 g/mol. Its IUPAC name is ethyl 2,2-diisocyanoethanimidate.
| Compound Name | ethyl 2,2-diisocyanoethanimidate |
|---|---|
| PubChem CID | 90689305 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | ethyl 2,2-diisocyanoethanimidate |
| SMILES | [H]/N=C(\OCC)C([N+]#[C-])[N+]#[C-] |
| InChI | InChI=1S/C6H7N3O/c1-4-10-5(7)6(8-2)9-3/h6-7H,4H2,1H3/b7-5- |
| InChIKey | HMVHGSPDCGWBBQ-ALCCZGGFSA-N |
| XLogP | 1.16 |
| TPSA | 41.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|