C10H12N4 — CID 90690952
3-amino-1-hexa-2,4-dien-2-ylpyrazole-4-carbonitrile (PubChem CID 90690952) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-amino-1-hexa-2,4-dien-2-ylpyrazole-4-carbonitrile.
| Compound Name | 3-amino-1-hexa-2,4-dien-2-ylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 90690952 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 3-amino-1-hexa-2,4-dien-2-ylpyrazole-4-carbonitrile |
| SMILES | CC=CC=C(C)n1cc(C#N)c(N)n1 |
| InChI | InChI=1S/C10H12N4/c1-3-4-5-8(2)14-7-9(6-11)10(12)13-14/h3-5,7H,1-2H3,(H2,12,13) |
| InChIKey | DHMPCZAXTBPJDZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|