C23H29N3O3 — CID 9069273
ethyl N-[3-[[2-(piperidin-1-ylmethyl)phenyl]methylcarbamoyl]phenyl]carbamate (PubChem CID 9069273) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is ethyl N-[3-[[2-(piperidin-1-ylmethyl)phenyl]methylcarbamoyl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[[2-(piperidin-1-ylmethyl)phenyl]methylcarbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 9069273 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | ethyl N-[3-[[2-(piperidin-1-ylmethyl)phenyl]methylcarbamoyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(C(=O)NCc2ccccc2CN2CCCCC2)c1 |
| InChI | InChI=1S/C23H29N3O3/c1-2-29-23(28)25-21-12-8-11-18(15-21)22(27)24-16-19-9-4-5-10-20(19)17-26-13-6-3-7-14-26/h4-5,8-12,15H,2-3,6-7,13-14,16-17H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | ZZIOYZICIAKMGI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |