C15H25N3O3S — CID 90693620
ethane;5-(methylsulfanylmethyl)-3-phenyl-1,2,4-oxadiazole;nitromethane (PubChem CID 90693620) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is ethane;5-(methylsulfanylmethyl)-3-phenyl-1,2,4-oxadiazole;nitromethane.
| Compound Name | ethane;5-(methylsulfanylmethyl)-3-phenyl-1,2,4-oxadiazole;nitromethane |
|---|---|
| PubChem CID | 90693620 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | ethane;5-(methylsulfanylmethyl)-3-phenyl-1,2,4-oxadiazole;nitromethane |
| SMILES | CC.CC.CSCc1nc(-c2ccccc2)no1.C[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N2OS.2C2H6.CH3NO2/c1-14-7-9-11-10(12-13-9)8-5-3-2-4-6-8;2*1-2;1-2(3)4/h2-6H,7H2,1H3;2*1-2H3;1H3 |
| InChIKey | GHPYYWCIEZKZQJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|