C17H19NO — CID 90693753
1-naphthalen-2-yl-2-(pent-4-enylamino)ethanone (PubChem CID 90693753) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is 1-naphthalen-2-yl-2-(pent-4-enylamino)ethanone.
| Compound Name | 1-naphthalen-2-yl-2-(pent-4-enylamino)ethanone |
|---|---|
| PubChem CID | 90693753 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-naphthalen-2-yl-2-(pent-4-enylamino)ethanone |
| SMILES | C=CCCCNCC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H19NO/c1-2-3-6-11-18-13-17(19)16-10-9-14-7-4-5-8-15(14)12-16/h2,4-5,7-10,12,18H,1,3,6,11,13H2 |
| InChIKey | CGVXGXFVFOHGEN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|