C21H22FN2O2+ — CID 9069417
[2-[[[5-(4-fluorophenyl)furan-2-carbonyl]amino]methyl]phenyl]methyl-dimethylazanium (PubChem CID 9069417) has the molecular formula C21H22FN2O2+ and a molecular weight of 353.42 g/mol. Its IUPAC name is [2-[[[5-(4-fluorophenyl)furan-2-carbonyl]amino]methyl]phenyl]methyl-dimethylazanium.
| Compound Name | [2-[[[5-(4-fluorophenyl)furan-2-carbonyl]amino]methyl]phenyl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 9069417 |
| Molecular Formula | C21H22FN2O2+ |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | [2-[[[5-(4-fluorophenyl)furan-2-carbonyl]amino]methyl]phenyl]methyl-dimethylazanium |
| SMILES | C[NH+](C)Cc1ccccc1CNC(=O)c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C21H21FN2O2/c1-24(2)14-17-6-4-3-5-16(17)13-23-21(25)20-12-11-19(26-20)15-7-9-18(22)10-8-15/h3-12H,13-14H2,1-2H3,(H,23,25)/p+1 |
| InChIKey | ACBSBWHBABJFMU-UHFFFAOYSA-O |
| XLogP | 2.66 |
| TPSA | 46.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |