C26H27N3O6 — CID 90694210
[(2R,4R)-4-hydroxy-1-(5-phenylpenta-2,4-dienoyl)pyrrolidin-2-yl] N-[4-(3-oxomorpholin-4-yl)phenyl]carbamate (PubChem CID 90694210) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is [(2R,4R)-4-hydroxy-1-(5-phenylpenta-2,4-dienoyl)pyrrolidin-2-yl] N-[4-(3-oxomorpholin-4-yl)phenyl]carbamate.
| Compound Name | [(2R,4R)-4-hydroxy-1-(5-phenylpenta-2,4-dienoyl)pyrrolidin-2-yl] N-[4-(3-oxomorpholin-4-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 90694210 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | [(2R,4R)-4-hydroxy-1-(5-phenylpenta-2,4-dienoyl)pyrrolidin-2-yl] N-[4-(3-oxomorpholin-4-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(N2CCOCC2=O)cc1)O[C@@H]1C[C@@H](O)CN1C(=O)C=CC=Cc1ccccc1 |
| InChI | InChI=1S/C26H27N3O6/c30-22-16-25(29(17-22)23(31)9-5-4-8-19-6-2-1-3-7-19)35-26(33)27-20-10-12-21(13-11-20)28-14-15-34-18-24(28)32/h1-13,22,25,30H,14-18H2,(H,27,33)/t22-,25-/m1/s1 |
| InChIKey | QWOVTFRPSTZDDS-RCZVLFRGSA-N |
| XLogP | 2.79 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|