C11H16O3 — CID 90694753
5-ethenyl-1,2,3-trimethoxycyclohexa-1,3-diene (PubChem CID 90694753) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-ethenyl-1,2,3-trimethoxycyclohexa-1,3-diene.
| Compound Name | 5-ethenyl-1,2,3-trimethoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 90694753 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 5-ethenyl-1,2,3-trimethoxycyclohexa-1,3-diene |
| SMILES | C=CC1C=C(OC)C(OC)=C(OC)C1 |
| InChI | InChI=1S/C11H16O3/c1-5-8-6-9(12-2)11(14-4)10(7-8)13-3/h5-6,8H,1,7H2,2-4H3 |
| InChIKey | XILCCDKDTHQVBM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|