C8H12O — CID 24827229
(4R)-6-ethenyl-4-methyl-3,4-dihydro-2H-pyran (PubChem CID 24827229) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is (4R)-6-ethenyl-4-methyl-3,4-dihydro-2H-pyran.
| Compound Name | (4R)-6-ethenyl-4-methyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 24827229 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (4R)-6-ethenyl-4-methyl-3,4-dihydro-2H-pyran |
| SMILES | C=CC1=C[C@H](C)CCO1 |
| InChI | InChI=1S/C8H12O/c1-3-8-6-7(2)4-5-9-8/h3,6-7H,1,4-5H2,2H3/t7-/m1/s1 |
| InChIKey | FRGCEPKMQPDIIY-SSDOTTSWSA-N |
| XLogP | 2.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |