C30H35F2N3O2+2 — CID 90694824
3-[2-ethyl-2-[2-(1-ethyl-4-hexylpyridin-1-ium-2-yl)-3,5-difluorophenyl]cyclopropylidene]-6-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one (PubChem CID 90694824) has the molecular formula C30H35F2N3O2+2 and a molecular weight of 507.63 g/mol. Its IUPAC name is 3-[2-ethyl-2-[2-(1-ethyl-4-hexylpyridin-1-ium-2-yl)-3,5-difluorophenyl]cyclopropylidene]-6-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one.
| Compound Name | 3-[2-ethyl-2-[2-(1-ethyl-4-hexylpyridin-1-ium-2-yl)-3,5-difluorophenyl]cyclopropylidene]-6-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one |
|---|---|
| PubChem CID | 90694824 |
| Molecular Formula | C30H35F2N3O2+2 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 3-[2-ethyl-2-[2-(1-ethyl-4-hexylpyridin-1-ium-2-yl)-3,5-difluorophenyl]cyclopropylidene]-6-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one |
| SMILES | CCCCCCc1cc[n+](CC)c(-c2c(F)cc(F)cc2C2(CC)CC2=c2oc(=O)c3c[n+](C)cn23)c1 |
| InChI | InChI=1S/C30H35F2N3O2/c1-5-8-9-10-11-20-12-13-34(7-3)25(14-20)27-22(15-21(31)16-24(27)32)30(6-2)17-23(30)28-35-19-33(4)18-26(35)29(36)37-28/h12-16,18-19H,5-11,17H2,1-4H3/q+2 |
| InChIKey | QOGBNZMCMLSXAV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 42.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|