C24H19Cl2F3N4O2S — CID 90695541
N-[[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]-(methylamino)methyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 90695541) has the molecular formula C24H19Cl2F3N4O2S and a molecular weight of 555.41 g/mol. Its IUPAC name is N-[[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]-(methylamino)methyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]-(methylamino)methyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90695541 |
| Molecular Formula | C24H19Cl2F3N4O2S |
| Molecular Weight | 555.41 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | N-[[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]-(methylamino)methyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CNC(NS(=O)(=O)c1ccc(C(F)(F)F)cc1)c1cc(-c2ccccc2)n(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C24H19Cl2F3N4O2S/c1-30-23(32-36(34,35)18-10-7-16(8-11-18)24(27,28)29)20-14-22(15-5-3-2-4-6-15)33(31-20)21-12-9-17(25)13-19(21)26/h2-14,23,30,32H,1H3 |
| InChIKey | KQWGUZVQSDCMRY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.41 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|