C24H27N2O2+ — CID 9069574
dimethyl-[[2-[[(4-naphthalen-2-yl-4-oxobutanoyl)amino]methyl]phenyl]methyl]azanium (PubChem CID 9069574) has the molecular formula C24H27N2O2+ and a molecular weight of 375.49 g/mol. Its IUPAC name is dimethyl-[[2-[[(4-naphthalen-2-yl-4-oxobutanoyl)amino]methyl]phenyl]methyl]azanium.
| Compound Name | dimethyl-[[2-[[(4-naphthalen-2-yl-4-oxobutanoyl)amino]methyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 9069574 |
| Molecular Formula | C24H27N2O2+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | dimethyl-[[2-[[(4-naphthalen-2-yl-4-oxobutanoyl)amino]methyl]phenyl]methyl]azanium |
| SMILES | C[NH+](C)Cc1ccccc1CNC(=O)CCC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H26N2O2/c1-26(2)17-22-10-6-5-9-21(22)16-25-24(28)14-13-23(27)20-12-11-18-7-3-4-8-19(18)15-20/h3-12,15H,13-14,16-17H2,1-2H3,(H,25,28)/p+1 |
| InChIKey | GIGHAQLGLLFMOB-UHFFFAOYSA-O |
| XLogP | 2.76 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |