C19H31N3O11 — CID 90695892
(2,5-dihydroxypyrrol-1-yl) 4-[1,3-bis(2-methoxyethylcarbamoyloxy)propan-2-yloxy]butanoate (PubChem CID 90695892) has the molecular formula C19H31N3O11 and a molecular weight of 477.47 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[1,3-bis(2-methoxyethylcarbamoyloxy)propan-2-yloxy]butanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[1,3-bis(2-methoxyethylcarbamoyloxy)propan-2-yloxy]butanoate |
|---|---|
| PubChem CID | 90695892 |
| Molecular Formula | C19H31N3O11 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[1,3-bis(2-methoxyethylcarbamoyloxy)propan-2-yloxy]butanoate |
| SMILES | COCCNC(=O)OCC(COC(=O)NCCOC)OCCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C19H31N3O11/c1-28-10-7-20-18(26)31-12-14(13-32-19(27)21-8-11-29-2)30-9-3-4-17(25)33-22-15(23)5-6-16(22)24/h5-6,14,23-24H,3-4,7-13H2,1-2H3,(H,20,26)(H,21,27) |
| InChIKey | HPJQRDNAVMXXLM-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 176.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|