C15H24N2O6 — CID 54123430
(2,5-dihydroxypyrrol-1-yl) (2S)-2-(butoxycarbonylamino)hexanoate (PubChem CID 54123430) has the molecular formula C15H24N2O6 and a molecular weight of 328.37 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2S)-2-(butoxycarbonylamino)hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2S)-2-(butoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 54123430 |
| Molecular Formula | C15H24N2O6 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2S)-2-(butoxycarbonylamino)hexanoate |
| SMILES | CCCCOC(=O)N[C@@H](CCCC)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C15H24N2O6/c1-3-5-7-11(16-15(21)22-10-6-4-2)14(20)23-17-12(18)8-9-13(17)19/h8-9,11,18-19H,3-7,10H2,1-2H3,(H,16,21)/t11-/m0/s1 |
| InChIKey | NPHWLFSEABFSRI-NSHDSACASA-N |
| XLogP | 1.94 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|