C26H30Cl2FN3O2 — CID 90696270
4-cyclohexyl-1-[2-(3,6-dichloro-2-fluoroanilino)-6-ethoxy-1-methylbenzimidazol-5-yl]butan-1-one (PubChem CID 90696270) has the molecular formula C26H30Cl2FN3O2 and a molecular weight of 506.45 g/mol. Its IUPAC name is 4-cyclohexyl-1-[2-(3,6-dichloro-2-fluoroanilino)-6-ethoxy-1-methylbenzimidazol-5-yl]butan-1-one.
| Compound Name | 4-cyclohexyl-1-[2-(3,6-dichloro-2-fluoroanilino)-6-ethoxy-1-methylbenzimidazol-5-yl]butan-1-one |
|---|---|
| PubChem CID | 90696270 |
| Molecular Formula | C26H30Cl2FN3O2 |
| Molecular Weight | 506.45 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 4-cyclohexyl-1-[2-(3,6-dichloro-2-fluoroanilino)-6-ethoxy-1-methylbenzimidazol-5-yl]butan-1-one |
| SMILES | CCOc1cc2c(cc1C(=O)CCCC1CCCCC1)nc(Nc1c(Cl)ccc(Cl)c1F)n2C |
| InChI | InChI=1S/C26H30Cl2FN3O2/c1-3-34-23-15-21-20(14-17(23)22(33)11-7-10-16-8-5-4-6-9-16)30-26(32(21)2)31-25-19(28)13-12-18(27)24(25)29/h12-16H,3-11H2,1-2H3,(H,30,31) |
| InChIKey | UICXDTJIQOTHPF-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.45 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|