C27H23F3N2O3 — CID 90696669
2,4,5-trifluoro-N-[3-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]phenyl]benzamide (PubChem CID 90696669) has the molecular formula C27H23F3N2O3 and a molecular weight of 480.49 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-[3-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]phenyl]benzamide.
| Compound Name | 2,4,5-trifluoro-N-[3-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 90696669 |
| Molecular Formula | C27H23F3N2O3 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2,4,5-trifluoro-N-[3-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]phenyl]benzamide |
| SMILES | COc1ccc2c(c1)C(CC(=O)c1cccc(NC(=O)c3cc(F)c(F)cc3F)c1)=NC(C)(C)C2 |
| InChI | InChI=1S/C27H23F3N2O3/c1-27(2)14-16-7-8-18(35-3)10-19(16)24(32-27)13-25(33)15-5-4-6-17(9-15)31-26(34)20-11-22(29)23(30)12-21(20)28/h4-12H,13-14H2,1-3H3,(H,31,34) |
| InChIKey | QBQZSJOKTHFITC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|