C24H26N2O4 — CID 91290532
prop-2-enyl N-[3-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]phenyl]carbamate (PubChem CID 91290532) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is prop-2-enyl N-[3-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]phenyl]carbamate.
| Compound Name | prop-2-enyl N-[3-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]phenyl]carbamate |
|---|---|
| PubChem CID | 91290532 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | prop-2-enyl N-[3-[2-(7-methoxy-3,3-dimethyl-4H-isoquinolin-1-yl)acetyl]phenyl]carbamate |
| SMILES | C=CCOC(=O)Nc1cccc(C(=O)CC2=NC(C)(C)Cc3ccc(OC)cc32)c1 |
| InChI | InChI=1S/C24H26N2O4/c1-5-11-30-23(28)25-18-8-6-7-16(12-18)22(27)14-21-20-13-19(29-4)10-9-17(20)15-24(2,3)26-21/h5-10,12-13H,1,11,14-15H2,2-4H3,(H,25,28) |
| InChIKey | SWISSGYDISZTIR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|