About 2-amino-3-(2,6-diaminophenyl)benzenethiol
2-amino-3-(2,6-diaminophenyl)benzenethiol (PubChem CID 90697488) has the molecular formula C12H13N3S
and a molecular weight of 231.32 g/mol. Its IUPAC name is 2-amino-3-(2,6-diaminophenyl)benzenethiol.
Molecular Properties
| Compound Name | 2-amino-3-(2,6-diaminophenyl)benzenethiol |
| PubChem CID | 90697488 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 2-amino-3-(2,6-diaminophenyl)benzenethiol |
| SMILES | Nc1cccc(N)c1-c1cccc(S)c1N |
| InChI | InChI=1S/C12H13N3S/c13-8-4-2-5-9(14)11(8)7-3-1-6-10(16)12(7)15/h1-6,16H,13-15H2 |
| InChIKey | SKEKFQJQYQDYLK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-(2,6-diaminophenyl)benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(2,6-diaminophenyl)benzenethiol?
The IUPAC name of 2-amino-3-(2,6-diaminophenyl)benzenethiol (CID 90697488) is 2-amino-3-(2,6-diaminophenyl)benzenethiol.
What is the SMILES notation for 2-amino-3-(2,6-diaminophenyl)benzenethiol?
The canonical SMILES for 2-amino-3-(2,6-diaminophenyl)benzenethiol is Nc1cccc(N)c1-c1cccc(S)c1N.
What is the InChIKey of 2-amino-3-(2,6-diaminophenyl)benzenethiol?
The InChIKey is SKEKFQJQYQDYLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3S/c13-8-4-2-5-9(14)11(8)7-3-1-6-10(16)12(7)15/h1-6,16H,13-15H2.
What are the key properties of 2-amino-3-(2,6-diaminophenyl)benzenethiol?
2-amino-3-(2,6-diaminophenyl)benzenethiol has a molecular weight of 231.32 g/mol, XLogP of 2.39, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(2,6-diaminophenyl)benzenethiol is sourced from PubChem (CID 90697488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).