C11H11FN2O — CID 90697577
7-fluoro-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol (PubChem CID 90697577) has the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. Its IUPAC name is 7-fluoro-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol.
| Compound Name | 7-fluoro-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol |
|---|---|
| PubChem CID | 90697577 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 7-fluoro-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol |
| SMILES | Oc1c2c(F)cccc2c2n1CCNC2 |
| InChI | InChI=1S/C11H11FN2O/c12-8-3-1-2-7-9-6-13-4-5-14(9)11(15)10(7)8/h1-3,13,15H,4-6H2 |
| InChIKey | LJLVCHLOUQHBOA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |