C17H30O3 — CID 90697846
2,2-dimethylpentadecane-3,4,10-trione (PubChem CID 90697846) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 2,2-dimethylpentadecane-3,4,10-trione.
| Compound Name | 2,2-dimethylpentadecane-3,4,10-trione |
|---|---|
| PubChem CID | 90697846 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 2,2-dimethylpentadecane-3,4,10-trione |
| SMILES | CCCCCC(=O)CCCCCC(=O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H30O3/c1-5-6-8-11-14(18)12-9-7-10-13-15(19)16(20)17(2,3)4/h5-13H2,1-4H3 |
| InChIKey | JEFYMNBPSCJPCY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|