C13H17N — CID 90698309
1-methyl-6-(6-methylcyclohexen-1-yl)pyridine (PubChem CID 90698309) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-methyl-6-(6-methylcyclohexen-1-yl)pyridine.
| Compound Name | 1-methyl-6-(6-methylcyclohexen-1-yl)pyridine |
|---|---|
| PubChem CID | 90698309 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-methyl-6-(6-methylcyclohexen-1-yl)pyridine |
| SMILES | CC1CCCC=C1C1=C=CC=CN1C |
| InChI | InChI=1S/C13H17N/c1-11-7-3-4-8-12(11)13-9-5-6-10-14(13)2/h5-6,8,10-11H,3-4,7H2,1-2H3 |
| InChIKey | BTEJAEMNCYFBJZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |