C36H35FN2O3Si — CID 90698921
9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-5-(2-trimethylsilylethoxy)pyrrolo[3,4-g]quinolin-8-ol (PubChem CID 90698921) has the molecular formula C36H35FN2O3Si and a molecular weight of 590.77 g/mol. Its IUPAC name is 9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-5-(2-trimethylsilylethoxy)pyrrolo[3,4-g]quinolin-8-ol.
| Compound Name | 9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-5-(2-trimethylsilylethoxy)pyrrolo[3,4-g]quinolin-8-ol |
|---|---|
| PubChem CID | 90698921 |
| Molecular Formula | C36H35FN2O3Si |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 9-benzhydryloxy-7-[(4-fluorophenyl)methyl]-5-(2-trimethylsilylethoxy)pyrrolo[3,4-g]quinolin-8-ol |
| SMILES | C[Si](C)(C)CCOc1c2cccnc2c(OC(c2ccccc2)c2ccccc2)c2c(O)n(Cc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C36H35FN2O3Si/c1-43(2,3)22-21-41-34-29-15-10-20-38-32(29)35(42-33(26-11-6-4-7-12-26)27-13-8-5-9-14-27)31-30(34)24-39(36(31)40)23-25-16-18-28(37)19-17-25/h4-20,24,33,40H,21-23H2,1-3H3 |
| InChIKey | ZXCOTUKGIMPYNT-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|