C23H24FN2O6P — CID 90692096
5-(diethoxyphosphorylmethoxy)-7-[(4-fluorophenyl)methyl]pyrrolo[3,4-g]quinoline-8,9-diol (PubChem CID 90692096) has the molecular formula C23H24FN2O6P and a molecular weight of 474.43 g/mol. Its IUPAC name is 5-(diethoxyphosphorylmethoxy)-7-[(4-fluorophenyl)methyl]pyrrolo[3,4-g]quinoline-8,9-diol.
| Compound Name | 5-(diethoxyphosphorylmethoxy)-7-[(4-fluorophenyl)methyl]pyrrolo[3,4-g]quinoline-8,9-diol |
|---|---|
| PubChem CID | 90692096 |
| Molecular Formula | C23H24FN2O6P |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 5-(diethoxyphosphorylmethoxy)-7-[(4-fluorophenyl)methyl]pyrrolo[3,4-g]quinoline-8,9-diol |
| SMILES | CCOP(=O)(COc1c2cccnc2c(O)c2c(O)n(Cc3ccc(F)cc3)cc12)OCC |
| InChI | InChI=1S/C23H24FN2O6P/c1-3-31-33(29,32-4-2)14-30-22-17-6-5-11-25-20(17)21(27)19-18(22)13-26(23(19)28)12-15-7-9-16(24)10-8-15/h5-11,13,27-28H,3-4,12,14H2,1-2H3 |
| InChIKey | NWBIPDKIIAMMGJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|