C23H22FN3O4 — CID 90699414
N-benzyl-2-[(4-fluorophenyl)methyl]-1,6,9-trioxo-4,7,8,9a-tetrahydro-3H-pyrido[1,2-a]pyrazine-7-carboxamide (PubChem CID 90699414) has the molecular formula C23H22FN3O4 and a molecular weight of 423.44 g/mol. Its IUPAC name is N-benzyl-2-[(4-fluorophenyl)methyl]-1,6,9-trioxo-4,7,8,9a-tetrahydro-3H-pyrido[1,2-a]pyrazine-7-carboxamide.
| Compound Name | N-benzyl-2-[(4-fluorophenyl)methyl]-1,6,9-trioxo-4,7,8,9a-tetrahydro-3H-pyrido[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 90699414 |
| Molecular Formula | C23H22FN3O4 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-benzyl-2-[(4-fluorophenyl)methyl]-1,6,9-trioxo-4,7,8,9a-tetrahydro-3H-pyrido[1,2-a]pyrazine-7-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CC(=O)C2C(=O)N(Cc3ccc(F)cc3)CCN2C1=O |
| InChI | InChI=1S/C23H22FN3O4/c24-17-8-6-16(7-9-17)14-26-10-11-27-20(23(26)31)19(28)12-18(22(27)30)21(29)25-13-15-4-2-1-3-5-15/h1-9,18,20H,10-14H2,(H,25,29) |
| InChIKey | DIIUDOAAWSQITH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|