C22H29NO3Si — CID 90699474
(8bS)-4-methyl-7-phenyl-3,3-di(propan-2-yl)-5,8b-dihydro-1H-oxasilolo[4,3-e]isoindole-6,8-diol (PubChem CID 90699474) has the molecular formula C22H29NO3Si and a molecular weight of 383.56 g/mol. Its IUPAC name is (8bS)-4-methyl-7-phenyl-3,3-di(propan-2-yl)-5,8b-dihydro-1H-oxasilolo[4,3-e]isoindole-6,8-diol.
| Compound Name | (8bS)-4-methyl-7-phenyl-3,3-di(propan-2-yl)-5,8b-dihydro-1H-oxasilolo[4,3-e]isoindole-6,8-diol |
|---|---|
| PubChem CID | 90699474 |
| Molecular Formula | C22H29NO3Si |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (8bS)-4-methyl-7-phenyl-3,3-di(propan-2-yl)-5,8b-dihydro-1H-oxasilolo[4,3-e]isoindole-6,8-diol |
| SMILES | CC1=C2[C@H](CO[Si]2(C(C)C)C(C)C)c2c(c(O)n(-c3ccccc3)c2O)C1 |
| InChI | InChI=1S/C22H29NO3Si/c1-13(2)27(14(3)4)20-15(5)11-17-19(18(20)12-26-27)22(25)23(21(17)24)16-9-7-6-8-10-16/h6-10,13-14,18,24-25H,11-12H2,1-5H3/t18-/m1/s1 |
| InChIKey | KNLQXARJTNXZIJ-GOSISDBHSA-N |
| XLogP | 5.18 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|