C16H14F3NO2 — CID 54348974
5-methyl-2-[3-(trifluoromethyl)phenyl]-4,7-dihydroisoindole-1,3-diol (PubChem CID 54348974) has the molecular formula C16H14F3NO2 and a molecular weight of 309.29 g/mol. Its IUPAC name is 5-methyl-2-[3-(trifluoromethyl)phenyl]-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 5-methyl-2-[3-(trifluoromethyl)phenyl]-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54348974 |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 5-methyl-2-[3-(trifluoromethyl)phenyl]-4,7-dihydroisoindole-1,3-diol |
| SMILES | CC1=CCc2c(c(O)n(-c3cccc(C(F)(F)F)c3)c2O)C1 |
| InChI | InChI=1S/C16H14F3NO2/c1-9-5-6-12-13(7-9)15(22)20(14(12)21)11-4-2-3-10(8-11)16(17,18)19/h2-5,8,21-22H,6-7H2,1H3 |
| InChIKey | UEINWNNOCRLJQY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|