C22H25N3OS — CID 90699531
4-methyl-2-methylsulfanyl-6-[[2-pyridin-2-ylethyl(pyridin-2-ylmethyl)amino]methyl]phenol (PubChem CID 90699531) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is 4-methyl-2-methylsulfanyl-6-[[2-pyridin-2-ylethyl(pyridin-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 4-methyl-2-methylsulfanyl-6-[[2-pyridin-2-ylethyl(pyridin-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 90699531 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 4-methyl-2-methylsulfanyl-6-[[2-pyridin-2-ylethyl(pyridin-2-ylmethyl)amino]methyl]phenol |
| SMILES | CSc1cc(C)cc(CN(CCc2ccccn2)Cc2ccccn2)c1O |
| InChI | InChI=1S/C22H25N3OS/c1-17-13-18(22(26)21(14-17)27-2)15-25(16-20-8-4-6-11-24-20)12-9-19-7-3-5-10-23-19/h3-8,10-11,13-14,26H,9,12,15-16H2,1-2H3 |
| InChIKey | ANAQDPPYPVLUHW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|