C18H27ClN4O — CID 90700065
[1-(3-chloro-5-methyl-4-pyridinyl)piperidin-4-yl]-(4-ethylpiperazin-1-yl)methanone (PubChem CID 90700065) has the molecular formula C18H27ClN4O and a molecular weight of 350.89 g/mol. Its IUPAC name is [1-(3-chloro-5-methyl-4-pyridinyl)piperidin-4-yl]-(4-ethylpiperazin-1-yl)methanone.
| Compound Name | [1-(3-chloro-5-methyl-4-pyridinyl)piperidin-4-yl]-(4-ethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 90700065 |
| Molecular Formula | C18H27ClN4O |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | [1-(3-chloro-5-methyl-4-pyridinyl)piperidin-4-yl]-(4-ethylpiperazin-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)C2CCN(c3c(C)cncc3Cl)CC2)CC1 |
| InChI | InChI=1S/C18H27ClN4O/c1-3-21-8-10-23(11-9-21)18(24)15-4-6-22(7-5-15)17-14(2)12-20-13-16(17)19/h12-13,15H,3-11H2,1-2H3 |
| InChIKey | ZBDNGHQSYJHWOE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |