C19H18N2O3 — CID 90702021
5,6-dimethoxy-2-(1-methylindol-5-yl)isoindol-1-ol (PubChem CID 90702021) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 5,6-dimethoxy-2-(1-methylindol-5-yl)isoindol-1-ol.
| Compound Name | 5,6-dimethoxy-2-(1-methylindol-5-yl)isoindol-1-ol |
|---|---|
| PubChem CID | 90702021 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 5,6-dimethoxy-2-(1-methylindol-5-yl)isoindol-1-ol |
| SMILES | COc1cc2cn(-c3ccc4c(ccn4C)c3)c(O)c2cc1OC |
| InChI | InChI=1S/C19H18N2O3/c1-20-7-6-12-8-14(4-5-16(12)20)21-11-13-9-17(23-2)18(24-3)10-15(13)19(21)22/h4-11,22H,1-3H3 |
| InChIKey | LMBRDGQIWAAXCN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 48.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |