C58H44N2OS3+2 — CID 90702507
2,2'-bis(9,9-dimethylfluoren-2-yl)-2-methylspiro[3H-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium-6,6'-[1,3]benzothiazolo[3,2-c][1,3]benzothiazin-7-ium] (PubChem CID 90702507) has the molecular formula C58H44N2OS3+2 and a molecular weight of 881.20 g/mol. Its IUPAC name is 2,2'-bis(9,9-dimethylfluoren-2-yl)-2-methylspiro[3H-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium-6,6'-[1,3]benzothiazolo[3,2-c][1,3]benzothiazin-7-ium].
| Compound Name | 2,2'-bis(9,9-dimethylfluoren-2-yl)-2-methylspiro[3H-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium-6,6'-[1,3]benzothiazolo[3,2-c][1,3]benzothiazin-7-ium] |
|---|---|
| PubChem CID | 90702507 |
| Molecular Formula | C58H44N2OS3+2 |
| Molecular Weight | 881.20 g/mol |
| Exact Mass | 880.26 |
| IUPAC Name | 2,2'-bis(9,9-dimethylfluoren-2-yl)-2-methylspiro[3H-[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium-6,6'-[1,3]benzothiazolo[3,2-c][1,3]benzothiazin-7-ium] |
| SMILES | CC1(c2ccc3c(c2)C(C)(C)c2ccccc2-3)C=C2C(=CC1)OC1(Sc3ccc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc3-c3sc4ccccc4[n+]31)[n+]1c2sc2ccccc21 |
| InChI | InChI=1S/C58H44N2OS3/c1-55(2)43-16-8-6-14-37(43)39-25-22-35(31-45(39)55)34-23-27-50-41(30-34)53-59(47-18-10-12-20-51(47)62-53)58(64-50)60-48-19-11-13-21-52(48)63-54(60)42-33-57(5,29-28-49(42)61-58)36-24-26-40-38-15-7-9-17-44(38)56(3,4)46(40)32-36/h6-28,30-33H,29H2,1-5H3/q+2 |
| InChIKey | MXTQDCJPJQTSSV-UHFFFAOYSA-N |
| XLogP | 14.52 |
| TPSA | 16.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.20 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|