C24H28F3NO5 — CID 90703003
ethyl 2-ethoxy-3-[3-[2-(ethoxyamino)-2-[4-(trifluoromethyl)phenyl]ethenoxy]phenyl]propanoate (PubChem CID 90703003) has the molecular formula C24H28F3NO5 and a molecular weight of 467.48 g/mol. Its IUPAC name is ethyl 2-ethoxy-3-[3-[2-(ethoxyamino)-2-[4-(trifluoromethyl)phenyl]ethenoxy]phenyl]propanoate.
| Compound Name | ethyl 2-ethoxy-3-[3-[2-(ethoxyamino)-2-[4-(trifluoromethyl)phenyl]ethenoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 90703003 |
| Molecular Formula | C24H28F3NO5 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | ethyl 2-ethoxy-3-[3-[2-(ethoxyamino)-2-[4-(trifluoromethyl)phenyl]ethenoxy]phenyl]propanoate |
| SMILES | CCONC(=COc1cccc(CC(OCC)C(=O)OCC)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H28F3NO5/c1-4-30-22(23(29)31-5-2)15-17-8-7-9-20(14-17)32-16-21(28-33-6-3)18-10-12-19(13-11-18)24(25,26)27/h7-14,16,22,28H,4-6,15H2,1-3H3 |
| InChIKey | XSXYHINCCKMOBD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|