C20H20F3NO4 — CID 91012551
2-[4-[1-[2-[4-(trifluoromethyl)phenyl]ethoxyamino]prop-1-enyl]phenoxy]acetic acid (PubChem CID 91012551) has the molecular formula C20H20F3NO4 and a molecular weight of 395.38 g/mol. Its IUPAC name is 2-[4-[1-[2-[4-(trifluoromethyl)phenyl]ethoxyamino]prop-1-enyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[1-[2-[4-(trifluoromethyl)phenyl]ethoxyamino]prop-1-enyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 91012551 |
| Molecular Formula | C20H20F3NO4 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-[4-[1-[2-[4-(trifluoromethyl)phenyl]ethoxyamino]prop-1-enyl]phenoxy]acetic acid |
| SMILES | CC=C(NOCCc1ccc(C(F)(F)F)cc1)c1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C20H20F3NO4/c1-2-18(15-5-9-17(10-6-15)27-13-19(25)26)24-28-12-11-14-3-7-16(8-4-14)20(21,22)23/h2-10,24H,11-13H2,1H3,(H,25,26) |
| InChIKey | HAVQTRURYJEAPY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|