C19H20F3NO2 — CID 57269955
N-ethoxy-1-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]prop-1-en-1-amine (PubChem CID 57269955) has the molecular formula C19H20F3NO2 and a molecular weight of 351.37 g/mol. Its IUPAC name is N-ethoxy-1-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]prop-1-en-1-amine.
| Compound Name | N-ethoxy-1-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 57269955 |
| Molecular Formula | C19H20F3NO2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-ethoxy-1-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]prop-1-en-1-amine |
| SMILES | CC=C(NOCC)c1ccc(OCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H20F3NO2/c1-3-18(23-25-4-2)15-7-11-17(12-8-15)24-13-14-5-9-16(10-6-14)19(20,21)22/h3,5-12,23H,4,13H2,1-2H3 |
| InChIKey | VFEOVIZHJHSPQI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|